C13H12N2O2 — CID 133083379
5-[(4-methoxyphenyl)hydrazinylidene]cyclopenta-1,3-diene-1-carbaldehyde (PubChem CID 133083379) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)hydrazinylidene]cyclopenta-1,3-diene-1-carbaldehyde.
| Compound Name | 5-[(4-methoxyphenyl)hydrazinylidene]cyclopenta-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 133083379 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 5-[(4-methoxyphenyl)hydrazinylidene]cyclopenta-1,3-diene-1-carbaldehyde |
| SMILES | COc1ccc(NN=C2C=CC=C2C=O)cc1 |
| InChI | InChI=1S/C13H12N2O2/c1-17-12-7-5-11(6-8-12)14-15-13-4-2-3-10(13)9-16/h2-9,14H,1H3 |
| InChIKey | MQRMJFBEMKQISM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|