C32H12F13O4Sb — CID 133083534
[tris(4-fluorophenyl)-(2,3,4,5,6-pentafluorobenzoyl)oxy-λ5-stibanyl] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 133083534) has the molecular formula C32H12F13O4Sb and a molecular weight of 829.18 g/mol. Its IUPAC name is [tris(4-fluorophenyl)-(2,3,4,5,6-pentafluorobenzoyl)oxy-λ5-stibanyl] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [tris(4-fluorophenyl)-(2,3,4,5,6-pentafluorobenzoyl)oxy-λ5-stibanyl] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 133083534 |
| Molecular Formula | C32H12F13O4Sb |
| Molecular Weight | 829.18 g/mol |
| Exact Mass | 827.96 |
| IUPAC Name | [tris(4-fluorophenyl)-(2,3,4,5,6-pentafluorobenzoyl)oxy-λ5-stibanyl] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | O=C(O[Sb](OC(=O)c1c(F)c(F)c(F)c(F)c1F)(c1ccc(F)cc1)(c1ccc(F)cc1)c1ccc(F)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/2C7HF5O2.3C6H4F.Sb/c2*8-2-1(7(13)14)3(9)5(11)6(12)4(2)10;3*7-6-4-2-1-3-5-6;/h2*(H,13,14);3*2-5H;/q;;;;;+2/p-2 |
| InChIKey | DYASNCKLFCIKOW-UHFFFAOYSA-L |
| XLogP | 6.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.18 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|