C11H4Cl4FN — CID 133090143
3-chloro-5-fluoro-4-(2,3,4-trichlorophenyl)pyridine (PubChem CID 133090143) has the molecular formula C11H4Cl4FN and a molecular weight of 310.97 g/mol. Its IUPAC name is 3-chloro-5-fluoro-4-(2,3,4-trichlorophenyl)pyridine.
| Compound Name | 3-chloro-5-fluoro-4-(2,3,4-trichlorophenyl)pyridine |
|---|---|
| PubChem CID | 133090143 |
| Molecular Formula | C11H4Cl4FN |
| Molecular Weight | 310.97 g/mol |
| Exact Mass | 308.91 |
| IUPAC Name | 3-chloro-5-fluoro-4-(2,3,4-trichlorophenyl)pyridine |
| SMILES | Fc1cncc(Cl)c1-c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H4Cl4FN/c12-6-2-1-5(10(14)11(6)15)9-7(13)3-17-4-8(9)16/h1-4H |
| InChIKey | NCYXVLASCOSSQV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.97 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|