C12H5Cl3F3NO — CID 133091815
3-(2,3,5-trichlorophenyl)-5-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 133091815) has the molecular formula C12H5Cl3F3NO and a molecular weight of 342.53 g/mol. Its IUPAC name is 3-(2,3,5-trichlorophenyl)-5-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 3-(2,3,5-trichlorophenyl)-5-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 133091815 |
| Molecular Formula | C12H5Cl3F3NO |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | 3-(2,3,5-trichlorophenyl)-5-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(C(F)(F)F)cc1-c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H5Cl3F3NO/c13-6-2-7(10(15)9(14)3-6)8-1-5(12(16,17)18)4-19-11(8)20/h1-4H,(H,19,20) |
| InChIKey | FLVBTIGPXOHLQF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|