C13H8F2N2O — CID 133094154
2-[3-(2,3-difluorophenyl)-6-oxo-1H-pyridin-2-yl]acetonitrile (PubChem CID 133094154) has the molecular formula C13H8F2N2O and a molecular weight of 246.22 g/mol. Its IUPAC name is 2-[3-(2,3-difluorophenyl)-6-oxo-1H-pyridin-2-yl]acetonitrile.
| Compound Name | 2-[3-(2,3-difluorophenyl)-6-oxo-1H-pyridin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 133094154 |
| Molecular Formula | C13H8F2N2O |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-[3-(2,3-difluorophenyl)-6-oxo-1H-pyridin-2-yl]acetonitrile |
| SMILES | N#CCc1[nH]c(=O)ccc1-c1cccc(F)c1F |
| InChI | InChI=1S/C13H8F2N2O/c14-10-3-1-2-9(13(10)15)8-4-5-12(18)17-11(8)6-7-16/h1-5H,6H2,(H,17,18) |
| InChIKey | JMPUWWIOINKCOO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |