C12H23NO3 — CID 133106810
5-(3,3-diethoxypropyl)-3-methylpyrrolidin-2-one (PubChem CID 133106810) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 5-(3,3-diethoxypropyl)-3-methylpyrrolidin-2-one.
| Compound Name | 5-(3,3-diethoxypropyl)-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 133106810 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 5-(3,3-diethoxypropyl)-3-methylpyrrolidin-2-one |
| SMILES | CCOC(CCC1CC(C)C(=O)N1)OCC |
| InChI | InChI=1S/C12H23NO3/c1-4-15-11(16-5-2)7-6-10-8-9(3)12(14)13-10/h9-11H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | XQYWLWNUAJTHQX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|