C22H23F2N3O — CID 133114082
[(2S,3S,6S)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(2-methyl-3-pyridinyl)methanone (PubChem CID 133114082) has the molecular formula C22H23F2N3O and a molecular weight of 383.44 g/mol. Its IUPAC name is [(2S,3S,6S)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(2-methyl-3-pyridinyl)methanone.
| Compound Name | [(2S,3S,6S)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(2-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 133114082 |
| Molecular Formula | C22H23F2N3O |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [(2S,3S,6S)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(2-methyl-3-pyridinyl)methanone |
| SMILES | Cc1ncccc1C(=O)N1C[C@H](c2cc(F)cc(F)c2)[C@H]2[C@@H]1C1CCN2CC1 |
| InChI | InChI=1S/C22H23F2N3O/c1-13-18(3-2-6-25-13)22(28)27-12-19(15-9-16(23)11-17(24)10-15)21-20(27)14-4-7-26(21)8-5-14/h2-3,6,9-11,14,19-21H,4-5,7-8,12H2,1H3/t19-,20+,21+/m1/s1 |
| InChIKey | LGUUPYMKRZTTBW-HKBOAZHASA-N |
| XLogP | 3.37 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |