C20H20F2N4O — CID 56889830
[(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-pyrazin-2-ylmethanone (PubChem CID 56889830) has the molecular formula C20H20F2N4O and a molecular weight of 370.40 g/mol. Its IUPAC name is [(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 56889830 |
| Molecular Formula | C20H20F2N4O |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1C[C@H](c2cc(F)cc(F)c2)[C@@H]2[C@H]1C1CCN2CC1 |
| InChI | InChI=1S/C20H20F2N4O/c21-14-7-13(8-15(22)9-14)16-11-26(20(27)17-10-23-3-4-24-17)18-12-1-5-25(6-2-12)19(16)18/h3-4,7-10,12,16,18-19H,1-2,5-6,11H2/t16-,18-,19-/m1/s1 |
| InChIKey | SGAKCJGEYYOIHV-BHIYHBOVSA-N |
| XLogP | 2.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |