C20H22F2N4O — CID 72932008
[(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(1-methylpyrazol-3-yl)methanone (PubChem CID 72932008) has the molecular formula C20H22F2N4O and a molecular weight of 372.42 g/mol. Its IUPAC name is [(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(1-methylpyrazol-3-yl)methanone.
| Compound Name | [(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(1-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 72932008 |
| Molecular Formula | C20H22F2N4O |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | [(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(1-methylpyrazol-3-yl)methanone |
| SMILES | Cn1ccc(C(=O)N2C[C@H](c3cc(F)cc(F)c3)[C@@H]3[C@H]2C2CCN3CC2)n1 |
| InChI | InChI=1S/C20H22F2N4O/c1-24-5-4-17(23-24)20(27)26-11-16(13-8-14(21)10-15(22)9-13)19-18(26)12-2-6-25(19)7-3-12/h4-5,8-10,12,16,18-19H,2-3,6-7,11H2,1H3/t16-,18-,19-/m1/s1 |
| InChIKey | TWZIVPRVJJHQDJ-BHIYHBOVSA-N |
| XLogP | 2.40 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |