C21H22F2N4O — CID 56888209
(6-amino-3-pyridinyl)-[(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone (PubChem CID 56888209) has the molecular formula C21H22F2N4O and a molecular weight of 384.43 g/mol. Its IUPAC name is (6-amino-3-pyridinyl)-[(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone.
| Compound Name | (6-amino-3-pyridinyl)-[(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone |
|---|---|
| PubChem CID | 56888209 |
| Molecular Formula | C21H22F2N4O |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (6-amino-3-pyridinyl)-[(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone |
| SMILES | Nc1ccc(C(=O)N2C[C@H](c3cc(F)cc(F)c3)[C@@H]3[C@H]2C2CCN3CC2)cn1 |
| InChI | InChI=1S/C21H22F2N4O/c22-15-7-14(8-16(23)9-15)17-11-27(21(28)13-1-2-18(24)25-10-13)19-12-3-5-26(6-4-12)20(17)19/h1-2,7-10,12,17,19-20H,3-6,11H2,(H2,24,25)/t17-,19-,20-/m1/s1 |
| InChIKey | YVUIEURUMUPBKE-MISYRCLQSA-N |
| XLogP | 2.64 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |