C17H21NO5S — CID 133128716
7-[[ethyl-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]methyl]-4-methylchromen-2-one (PubChem CID 133128716) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is 7-[[ethyl-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]methyl]-4-methylchromen-2-one.
| Compound Name | 7-[[ethyl-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]methyl]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 133128716 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 7-[[ethyl-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]methyl]-4-methylchromen-2-one |
| SMILES | CCN(Cc1ccc2c(C)cc(=O)oc2c1)[C@@H]1CS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C17H21NO5S/c1-3-18(14-9-24(21,22)10-15(14)19)8-12-4-5-13-11(2)6-17(20)23-16(13)7-12/h4-7,14-15,19H,3,8-10H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | QWXCQKWBEDSDHH-HUUCEWRRSA-N |
| XLogP | 1.08 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|