C12H16Br2N2O — CID 13312962
9,9-dibromo-3-ethyl-2,6-dimethyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one (PubChem CID 13312962) has the molecular formula C12H16Br2N2O and a molecular weight of 364.08 g/mol. Its IUPAC name is 9,9-dibromo-3-ethyl-2,6-dimethyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 9,9-dibromo-3-ethyl-2,6-dimethyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 13312962 |
| Molecular Formula | C12H16Br2N2O |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | 9,9-dibromo-3-ethyl-2,6-dimethyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCc1c(C)nc2n(c1=O)C(C)CCC2(Br)Br |
| InChI | InChI=1S/C12H16Br2N2O/c1-4-9-8(3)15-11-12(13,14)6-5-7(2)16(11)10(9)17/h7H,4-6H2,1-3H3 |
| InChIKey | SPJTYWXEQRPSGQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|