C18H26N2O3S — CID 133137505
(4R,4aR,7aR)-N,N-dimethyl-6-[(4-methylphenyl)methyl]-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide (PubChem CID 133137505) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is (4R,4aR,7aR)-N,N-dimethyl-6-[(4-methylphenyl)methyl]-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide.
| Compound Name | (4R,4aR,7aR)-N,N-dimethyl-6-[(4-methylphenyl)methyl]-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 133137505 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (4R,4aR,7aR)-N,N-dimethyl-6-[(4-methylphenyl)methyl]-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide |
| SMILES | Cc1ccc(CN2C[C@H]3[C@H](C(=O)N(C)C)CCS(=O)(=O)[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H26N2O3S/c1-13-4-6-14(7-5-13)10-20-11-16-15(18(21)19(2)3)8-9-24(22,23)17(16)12-20/h4-7,15-17H,8-12H2,1-3H3/t15-,16+,17+/m1/s1 |
| InChIKey | IMEJMCBTYNHYKK-IKGGRYGDSA-N |
| XLogP | 1.32 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |