C8H14N2O — CID 133143470
(3aS,6aS)-5-prop-2-enyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c][1,2]oxazole (PubChem CID 133143470) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (3aS,6aS)-5-prop-2-enyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c][1,2]oxazole.
| Compound Name | (3aS,6aS)-5-prop-2-enyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 133143470 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (3aS,6aS)-5-prop-2-enyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c][1,2]oxazole |
| SMILES | C=CCN1C[C@@H]2CON[C@@H]2C1 |
| InChI | InChI=1S/C8H14N2O/c1-2-3-10-4-7-6-11-9-8(7)5-10/h2,7-9H,1,3-6H2/t7-,8-/m1/s1 |
| InChIKey | RBTYBSIBXMDICD-HTQZYQBOSA-N |
| XLogP | 0.01 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|