C24H27ClN4O2S — CID 133157135
1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-(1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157135) has the molecular formula C24H27ClN4O2S and a molecular weight of 471.03 g/mol. Its IUPAC name is 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-(1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-(1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157135 |
| Molecular Formula | C24H27ClN4O2S |
| Molecular Weight | 471.03 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-(1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COCCOc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccn(C(C)C)c2)cc1Cl |
| InChI | InChI=1S/C24H27ClN4O2S/c1-16(2)28-11-9-17(15-28)23-22(20-6-4-5-10-26-20)27-24(32)29(23)18-7-8-21(19(25)14-18)31-13-12-30-3/h4-11,14-16,22-23H,12-13H2,1-3H3,(H,27,32) |
| InChIKey | LHYRMCRSDHGVSY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.03 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|