C22H23BrN4S — CID 133224274
1-(4-bromo-3-methylphenyl)-5-(1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133224274) has the molecular formula C22H23BrN4S and a molecular weight of 455.43 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-5-(1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-bromo-3-methylphenyl)-5-(1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133224274 |
| Molecular Formula | C22H23BrN4S |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-5-(1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)NC(c3ccccn3)C2c2ccn(C(C)C)c2)ccc1Br |
| InChI | InChI=1S/C22H23BrN4S/c1-14(2)26-11-9-16(13-26)21-20(19-6-4-5-10-24-19)25-22(28)27(21)17-7-8-18(23)15(3)12-17/h4-14,20-21H,1-3H3,(H,25,28) |
| InChIKey | XMRLXKOXQXWFDA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|