C9H15NO2 — CID 13317033
4-(3,6-dihydro-2H-pyran-5-yl)morpholine (PubChem CID 13317033) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 4-(3,6-dihydro-2H-pyran-5-yl)morpholine.
| Compound Name | 4-(3,6-dihydro-2H-pyran-5-yl)morpholine |
|---|---|
| PubChem CID | 13317033 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 4-(3,6-dihydro-2H-pyran-5-yl)morpholine |
| SMILES | C1=C(N2CCOCC2)COCC1 |
| InChI | InChI=1S/C9H15NO2/c1-2-9(8-12-5-1)10-3-6-11-7-4-10/h2H,1,3-8H2 |
| InChIKey | VYKGOZPSSRWSOR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |