C10H13ClN2O2S — CID 133180231
[2-(3-chlorophenyl)-1,1-dioxo-1,2-thiazolidin-5-yl]methanamine (PubChem CID 133180231) has the molecular formula C10H13ClN2O2S and a molecular weight of 260.75 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-1,1-dioxo-1,2-thiazolidin-5-yl]methanamine.
| Compound Name | [2-(3-chlorophenyl)-1,1-dioxo-1,2-thiazolidin-5-yl]methanamine |
|---|---|
| PubChem CID | 133180231 |
| Molecular Formula | C10H13ClN2O2S |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | [2-(3-chlorophenyl)-1,1-dioxo-1,2-thiazolidin-5-yl]methanamine |
| SMILES | NCC1CCN(c2cccc(Cl)c2)S1(=O)=O |
| InChI | InChI=1S/C10H13ClN2O2S/c11-8-2-1-3-9(6-8)13-5-4-10(7-12)16(13,14)15/h1-3,6,10H,4-5,7,12H2 |
| InChIKey | VWCXBIKXUNZLIK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |