C23H30N2O3S2 — CID 133229568
3-(4-methylpiperidine-1-carbonyl)-4-methylsulfanyl-N-(2-phenylpropyl)benzenesulfonamide (PubChem CID 133229568) has the molecular formula C23H30N2O3S2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 3-(4-methylpiperidine-1-carbonyl)-4-methylsulfanyl-N-(2-phenylpropyl)benzenesulfonamide.
| Compound Name | 3-(4-methylpiperidine-1-carbonyl)-4-methylsulfanyl-N-(2-phenylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133229568 |
| Molecular Formula | C23H30N2O3S2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 3-(4-methylpiperidine-1-carbonyl)-4-methylsulfanyl-N-(2-phenylpropyl)benzenesulfonamide |
| SMILES | CSc1ccc(S(=O)(=O)NCC(C)c2ccccc2)cc1C(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C23H30N2O3S2/c1-17-11-13-25(14-12-17)23(26)21-15-20(9-10-22(21)29-3)30(27,28)24-16-18(2)19-7-5-4-6-8-19/h4-10,15,17-18,24H,11-14,16H2,1-3H3 |
| InChIKey | JVVMSUFPDYHDCA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |