C20H21ClN2O4 — CID 13324737
(E)-but-2-enedioic acid;[3-[(5-chloro-2,3-dihydroindol-1-yl)methyl]phenyl]methanamine (PubChem CID 13324737) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;[3-[(5-chloro-2,3-dihydroindol-1-yl)methyl]phenyl]methanamine.
| Compound Name | (E)-but-2-enedioic acid;[3-[(5-chloro-2,3-dihydroindol-1-yl)methyl]phenyl]methanamine |
|---|---|
| PubChem CID | 13324737 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (E)-but-2-enedioic acid;[3-[(5-chloro-2,3-dihydroindol-1-yl)methyl]phenyl]methanamine |
| SMILES | NCc1cccc(CN2CCc3cc(Cl)ccc32)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H17ClN2.C4H4O4/c17-15-4-5-16-14(9-15)6-7-19(16)11-13-3-1-2-12(8-13)10-18;5-3(6)1-2-4(7)8/h1-5,8-9H,6-7,10-11,18H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | OGSFYXWLYCJRFI-WLHGVMLRSA-N |
| XLogP | 3.07 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|