C15H18N8OS — CID 133268568
N-[3-(1,3-benzothiazol-2-yl)propyl]-3-(tetrazol-1-yl)pyrazolidine-4-carboxamide (PubChem CID 133268568) has the molecular formula C15H18N8OS and a molecular weight of 358.43 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-3-(tetrazol-1-yl)pyrazolidine-4-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-3-(tetrazol-1-yl)pyrazolidine-4-carboxamide |
|---|---|
| PubChem CID | 133268568 |
| Molecular Formula | C15H18N8OS |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-3-(tetrazol-1-yl)pyrazolidine-4-carboxamide |
| SMILES | O=C(NCCCc1nc2ccccc2s1)C1CNNC1n1cnnn1 |
| InChI | InChI=1S/C15H18N8OS/c24-15(10-8-17-20-14(10)23-9-18-21-22-23)16-7-3-6-13-19-11-4-1-2-5-12(11)25-13/h1-2,4-5,9-10,14,17,20H,3,6-8H2,(H,16,24) |
| InChIKey | MFLOBBDSRVXXJM-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|