C17H16FN5O4S — CID 133271623
3-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]sulfonyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 133271623) has the molecular formula C17H16FN5O4S and a molecular weight of 405.41 g/mol. Its IUPAC name is 3-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]sulfonyl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]sulfonyl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 133271623 |
| Molecular Formula | C17H16FN5O4S |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 3-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]sulfonyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(S(=O)(=O)c3c[nH]c4ncccc34)CC2)c(F)c1 |
| InChI | InChI=1S/C17H16FN5O4S/c18-14-10-12(23(24)25)3-4-15(14)21-6-8-22(9-7-21)28(26,27)16-11-20-17-13(16)2-1-5-19-17/h1-5,10-11H,6-9H2,(H,19,20) |
| InChIKey | LAFUUYVKGFOJAR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 112.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|