C18H20N8O4S — CID 55988292
N-cyclopropyl-5-nitro-2-[4-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperazin-1-yl]pyrimidin-4-amine (PubChem CID 55988292) has the molecular formula C18H20N8O4S and a molecular weight of 444.48 g/mol. Its IUPAC name is N-cyclopropyl-5-nitro-2-[4-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperazin-1-yl]pyrimidin-4-amine.
| Compound Name | N-cyclopropyl-5-nitro-2-[4-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 55988292 |
| Molecular Formula | C18H20N8O4S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-cyclopropyl-5-nitro-2-[4-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperazin-1-yl]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1cnc(N2CCN(S(=O)(=O)c3c[nH]c4ncccc34)CC2)nc1NC1CC1 |
| InChI | InChI=1S/C18H20N8O4S/c27-26(28)14-10-21-18(23-17(14)22-12-3-4-12)24-6-8-25(9-7-24)31(29,30)15-11-20-16-13(15)2-1-5-19-16/h1-2,5,10-12H,3-4,6-9H2,(H,19,20)(H,21,22,23) |
| InChIKey | BPRBGMINRJQZFZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|