C13H15N3O3S — CID 63845027
1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidine-4-carbaldehyde (PubChem CID 63845027) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidine-4-carbaldehyde.
| Compound Name | 1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 63845027 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidine-4-carbaldehyde |
| SMILES | O=CC1CCN(S(=O)(=O)c2c[nH]c3ncccc23)CC1 |
| InChI | InChI=1S/C13H15N3O3S/c17-9-10-3-6-16(7-4-10)20(18,19)12-8-15-13-11(12)2-1-5-14-13/h1-2,5,8-10H,3-4,6-7H2,(H,14,15) |
| InChIKey | SDMFHVKSFBFXQX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|