C16H21N3O2S — CID 128851562
3-(3-cyclopentylpyrrolidin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 128851562) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 3-(3-cyclopentylpyrrolidin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(3-cyclopentylpyrrolidin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 128851562 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-(3-cyclopentylpyrrolidin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | O=S(=O)(c1c[nH]c2ncccc12)N1CCC(C2CCCC2)C1 |
| InChI | InChI=1S/C16H21N3O2S/c20-22(21,15-10-18-16-14(15)6-3-8-17-16)19-9-7-13(11-19)12-4-1-2-5-12/h3,6,8,10,12-13H,1-2,4-5,7,9,11H2,(H,17,18) |
| InChIKey | FPNXRDXLQFMKOL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |