C17H20ClN3O2S — CID 133273417
[5-chloro-6-[1-(5-methylthiophen-2-yl)ethylamino]-3-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 133273417) has the molecular formula C17H20ClN3O2S and a molecular weight of 365.89 g/mol. Its IUPAC name is [5-chloro-6-[1-(5-methylthiophen-2-yl)ethylamino]-3-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [5-chloro-6-[1-(5-methylthiophen-2-yl)ethylamino]-3-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 133273417 |
| Molecular Formula | C17H20ClN3O2S |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | [5-chloro-6-[1-(5-methylthiophen-2-yl)ethylamino]-3-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | Cc1ccc(C(C)Nc2ncc(C(=O)N3CCOCC3)cc2Cl)s1 |
| InChI | InChI=1S/C17H20ClN3O2S/c1-11-3-4-15(24-11)12(2)20-16-14(18)9-13(10-19-16)17(22)21-5-7-23-8-6-21/h3-4,9-10,12H,5-8H2,1-2H3,(H,19,20) |
| InChIKey | PWJPOCRUQKIMGD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |