C14H12F2N4O3S — CID 133273714
N-[1-(2,4-difluorophenoxy)propan-2-yl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 133273714) has the molecular formula C14H12F2N4O3S and a molecular weight of 354.34 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenoxy)propan-2-yl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-[1-(2,4-difluorophenoxy)propan-2-yl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 133273714 |
| Molecular Formula | C14H12F2N4O3S |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | N-[1-(2,4-difluorophenoxy)propan-2-yl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CC(COc1ccc(F)cc1F)Nc1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12F2N4O3S/c1-8(7-23-11-3-2-9(15)6-10(11)16)17-12-13(20(21)22)19-4-5-24-14(19)18-12/h2-6,8,17H,7H2,1H3 |
| InChIKey | JSAXVSCAXTWQCU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|