C17H19N3O5S — CID 133274565
3-(2-methyl-6-phenylmorpholin-4-yl)-5-nitrobenzenesulfonamide (PubChem CID 133274565) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is 3-(2-methyl-6-phenylmorpholin-4-yl)-5-nitrobenzenesulfonamide.
| Compound Name | 3-(2-methyl-6-phenylmorpholin-4-yl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133274565 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 3-(2-methyl-6-phenylmorpholin-4-yl)-5-nitrobenzenesulfonamide |
| SMILES | CC1CN(c2cc([N+](=O)[O-])cc(S(N)(=O)=O)c2)CC(c2ccccc2)O1 |
| InChI | InChI=1S/C17H19N3O5S/c1-12-10-19(11-17(25-12)13-5-3-2-4-6-13)14-7-15(20(21)22)9-16(8-14)26(18,23)24/h2-9,12,17H,10-11H2,1H3,(H2,18,23,24) |
| InChIKey | UJOPKFRRTWRQNR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|