C14H17N5O4S — CID 133277912
3-nitro-5-(4-pyrazol-1-ylpiperidin-1-yl)benzenesulfonamide (PubChem CID 133277912) has the molecular formula C14H17N5O4S and a molecular weight of 351.39 g/mol. Its IUPAC name is 3-nitro-5-(4-pyrazol-1-ylpiperidin-1-yl)benzenesulfonamide.
| Compound Name | 3-nitro-5-(4-pyrazol-1-ylpiperidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 133277912 |
| Molecular Formula | C14H17N5O4S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 3-nitro-5-(4-pyrazol-1-ylpiperidin-1-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(N2CCC(n3cccn3)CC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H17N5O4S/c15-24(22,23)14-9-12(8-13(10-14)19(20)21)17-6-2-11(3-7-17)18-5-1-4-16-18/h1,4-5,8-11H,2-3,6-7H2,(H2,15,22,23) |
| InChIKey | IVRVOAYPWQYJSU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 124.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|