C14H10F3N5O2S — CID 133293645
2-nitro-N-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]-4-(trifluoromethyl)aniline (PubChem CID 133293645) has the molecular formula C14H10F3N5O2S and a molecular weight of 369.33 g/mol. Its IUPAC name is 2-nitro-N-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]-4-(trifluoromethyl)aniline.
| Compound Name | 2-nitro-N-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 133293645 |
| Molecular Formula | C14H10F3N5O2S |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2-nitro-N-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1NCc1nc(-c2cccs2)n[nH]1 |
| InChI | InChI=1S/C14H10F3N5O2S/c15-14(16,17)8-3-4-9(10(6-8)22(23)24)18-7-12-19-13(21-20-12)11-2-1-5-25-11/h1-6,18H,7H2,(H,19,20,21) |
| InChIKey | OXAFMTBKXZQUBU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|