C16H10F3N3O4S2 — CID 4129604
2,6-dinitro-N-[(5-thiophen-2-ylthiophen-2-yl)methyl]-4-(trifluoromethyl)aniline (PubChem CID 4129604) has the molecular formula C16H10F3N3O4S2 and a molecular weight of 429.40 g/mol. Its IUPAC name is 2,6-dinitro-N-[(5-thiophen-2-ylthiophen-2-yl)methyl]-4-(trifluoromethyl)aniline.
| Compound Name | 2,6-dinitro-N-[(5-thiophen-2-ylthiophen-2-yl)methyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 4129604 |
| Molecular Formula | C16H10F3N3O4S2 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 2,6-dinitro-N-[(5-thiophen-2-ylthiophen-2-yl)methyl]-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1NCc1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C16H10F3N3O4S2/c17-16(18,19)9-6-11(21(23)24)15(12(7-9)22(25)26)20-8-10-3-4-14(28-10)13-2-1-5-27-13/h1-7,20H,8H2 |
| InChIKey | JBALYFKTTLQJCU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|