C21H22FN5O — CID 133294446
6-ethyl-N-(3-fluoro-4-morpholin-4-ylphenyl)-2-pyridin-4-ylpyrimidin-4-amine (PubChem CID 133294446) has the molecular formula C21H22FN5O and a molecular weight of 379.44 g/mol. Its IUPAC name is 6-ethyl-N-(3-fluoro-4-morpholin-4-ylphenyl)-2-pyridin-4-ylpyrimidin-4-amine.
| Compound Name | 6-ethyl-N-(3-fluoro-4-morpholin-4-ylphenyl)-2-pyridin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133294446 |
| Molecular Formula | C21H22FN5O |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 6-ethyl-N-(3-fluoro-4-morpholin-4-ylphenyl)-2-pyridin-4-ylpyrimidin-4-amine |
| SMILES | CCc1cc(Nc2ccc(N3CCOCC3)c(F)c2)nc(-c2ccncc2)n1 |
| InChI | InChI=1S/C21H22FN5O/c1-2-16-14-20(26-21(25-16)15-5-7-23-8-6-15)24-17-3-4-19(18(22)13-17)27-9-11-28-12-10-27/h3-8,13-14H,2,9-12H2,1H3,(H,24,25,26) |
| InChIKey | AVRMBJCYLGHOTA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|