C16H16N4O3 — CID 133296390
methyl 6-[(2-oxo-1-phenylpyrrolidin-3-yl)amino]pyridazine-3-carboxylate (PubChem CID 133296390) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is methyl 6-[(2-oxo-1-phenylpyrrolidin-3-yl)amino]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[(2-oxo-1-phenylpyrrolidin-3-yl)amino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 133296390 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl 6-[(2-oxo-1-phenylpyrrolidin-3-yl)amino]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NC2CCN(c3ccccc3)C2=O)nn1 |
| InChI | InChI=1S/C16H16N4O3/c1-23-16(22)13-7-8-14(19-18-13)17-12-9-10-20(15(12)21)11-5-3-2-4-6-11/h2-8,12H,9-10H2,1H3,(H,17,19) |
| InChIKey | RRUQAPYYWGJRPI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |