C10H12N6 — CID 133299897
5-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)pentanenitrile (PubChem CID 133299897) has the molecular formula C10H12N6 and a molecular weight of 216.25 g/mol. Its IUPAC name is 5-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)pentanenitrile.
| Compound Name | 5-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)pentanenitrile |
|---|---|
| PubChem CID | 133299897 |
| Molecular Formula | C10H12N6 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 5-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)pentanenitrile |
| SMILES | N#CCCCCNc1ncnc2[nH]ncc12 |
| InChI | InChI=1S/C10H12N6/c11-4-2-1-3-5-12-9-8-6-15-16-10(8)14-7-13-9/h6-7H,1-3,5H2,(H2,12,13,14,15,16) |
| InChIKey | WTJMUOWXVMQYBE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|