C17H16N6O2 — CID 133307674
N,6-dimethyl-2-(3-nitrophenyl)-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine (PubChem CID 133307674) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is N,6-dimethyl-2-(3-nitrophenyl)-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | N,6-dimethyl-2-(3-nitrophenyl)-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 133307674 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N,6-dimethyl-2-(3-nitrophenyl)-N-(pyrazin-2-ylmethyl)pyrimidin-4-amine |
| SMILES | Cc1cc(N(C)Cc2cnccn2)nc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C17H16N6O2/c1-12-8-16(22(2)11-14-10-18-6-7-19-14)21-17(20-12)13-4-3-5-15(9-13)23(24)25/h3-10H,11H2,1-2H3 |
| InChIKey | BGHISUHZYCLXDA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|