C16H23N3O4S2 — CID 133309223
2,3-dimethyl-4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)thiomorpholine (PubChem CID 133309223) has the molecular formula C16H23N3O4S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2,3-dimethyl-4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)thiomorpholine.
| Compound Name | 2,3-dimethyl-4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)thiomorpholine |
|---|---|
| PubChem CID | 133309223 |
| Molecular Formula | C16H23N3O4S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2,3-dimethyl-4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)thiomorpholine |
| SMILES | CC1SCCN(c2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCCC2)C1C |
| InChI | InChI=1S/C16H23N3O4S2/c1-12-13(2)24-10-9-18(12)15-6-5-14(19(20)21)11-16(15)25(22,23)17-7-3-4-8-17/h5-6,11-13H,3-4,7-10H2,1-2H3 |
| InChIKey | KSKFANPCRUDNDQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|