C21H19N5O4S — CID 133312365
2-[1-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylamino]-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 133312365) has the molecular formula C21H19N5O4S and a molecular weight of 437.48 g/mol. Its IUPAC name is 2-[1-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylamino]-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[1-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylamino]-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 133312365 |
| Molecular Formula | C21H19N5O4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-[1-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylamino]-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | COc1ccc(-c2nc(C)c(C(C)Nc3nc4ccccn4c(=O)c3[N+](=O)[O-])s2)cc1 |
| InChI | InChI=1S/C21H19N5O4S/c1-12(18-13(2)23-20(31-18)14-7-9-15(30-3)10-8-14)22-19-17(26(28)29)21(27)25-11-5-4-6-16(25)24-19/h4-12,22H,1-3H3 |
| InChIKey | JERKIIXYEDPUCO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|