C19H17N5S2 — CID 133312926
2-pyridin-3-yl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]quinazolin-4-amine (PubChem CID 133312926) has the molecular formula C19H17N5S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is 2-pyridin-3-yl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]quinazolin-4-amine.
| Compound Name | 2-pyridin-3-yl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 133312926 |
| Molecular Formula | C19H17N5S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-pyridin-3-yl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]quinazolin-4-amine |
| SMILES | c1cncc(-c2nc(NCCCSc3nccs3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C19H17N5S2/c1-2-7-16-15(6-1)18(21-9-4-11-25-19-22-10-12-26-19)24-17(23-16)14-5-3-8-20-13-14/h1-3,5-8,10,12-13H,4,9,11H2,(H,21,23,24) |
| InChIKey | MNCQABGKHQCZNJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|