C19H22ClN5 — CID 133317369
3-chloro-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methylamino]benzonitrile (PubChem CID 133317369) has the molecular formula C19H22ClN5 and a molecular weight of 355.87 g/mol. Its IUPAC name is 3-chloro-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methylamino]benzonitrile.
| Compound Name | 3-chloro-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methylamino]benzonitrile |
|---|---|
| PubChem CID | 133317369 |
| Molecular Formula | C19H22ClN5 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 3-chloro-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methylamino]benzonitrile |
| SMILES | CCN1CCN(c2ccc(CNc3c(Cl)cccc3C#N)cn2)CC1 |
| InChI | InChI=1S/C19H22ClN5/c1-2-24-8-10-25(11-9-24)18-7-6-15(13-22-18)14-23-19-16(12-21)4-3-5-17(19)20/h3-7,13,23H,2,8-11,14H2,1H3 |
| InChIKey | WMMMFDUZSOJDRQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |