C15H18N2O4 — CID 133323689
ethyl 6-[[2-(furan-2-yl)-2-hydroxypropyl]amino]pyridine-3-carboxylate (PubChem CID 133323689) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl 6-[[2-(furan-2-yl)-2-hydroxypropyl]amino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[[2-(furan-2-yl)-2-hydroxypropyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133323689 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | ethyl 6-[[2-(furan-2-yl)-2-hydroxypropyl]amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NCC(C)(O)c2ccco2)nc1 |
| InChI | InChI=1S/C15H18N2O4/c1-3-20-14(18)11-6-7-13(16-9-11)17-10-15(2,19)12-5-4-8-21-12/h4-9,19H,3,10H2,1-2H3,(H,16,17) |
| InChIKey | KAYCBTPKEDPAKI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |