About 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile
6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile (PubChem CID 133325986) has the molecular formula C13H14N4S
and a molecular weight of 258.35 g/mol. Its IUPAC name is 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile |
| PubChem CID | 133325986 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile |
| SMILES | CCc1cnc(CCNc2ccc(C#N)cn2)s1 |
| InChI | InChI=1S/C13H14N4S/c1-2-11-9-17-13(18-11)5-6-15-12-4-3-10(7-14)8-16-12/h3-4,8-9H,2,5-6H2,1H3,(H,15,16) |
| InChIKey | RLGCXUYSKHWJCG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile?
The IUPAC name of 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile (CID 133325986) is 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile.
What is the SMILES notation for 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile?
The canonical SMILES for 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile is CCc1cnc(CCNc2ccc(C#N)cn2)s1.
What is the InChIKey of 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile?
The InChIKey is RLGCXUYSKHWJCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4S/c1-2-11-9-17-13(18-11)5-6-15-12-4-3-10(7-14)8-16-12/h3-4,8-9H,2,5-6H2,1H3,(H,15,16).
What are the key properties of 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile?
6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile has a molecular weight of 258.35 g/mol, XLogP of 2.63, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyridine-3-carbonitrile is sourced from PubChem (CID 133325986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).