C18H18F3N3O2S — CID 133329325
4-[2-(4-methyl-1H-indol-3-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 133329325) has the molecular formula C18H18F3N3O2S and a molecular weight of 397.42 g/mol. Its IUPAC name is 4-[2-(4-methyl-1H-indol-3-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-[2-(4-methyl-1H-indol-3-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133329325 |
| Molecular Formula | C18H18F3N3O2S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 4-[2-(4-methyl-1H-indol-3-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1cccc2[nH]cc(CCNc3ccc(S(N)(=O)=O)c(C(F)(F)F)c3)c12 |
| InChI | InChI=1S/C18H18F3N3O2S/c1-11-3-2-4-15-17(11)12(10-24-15)7-8-23-13-5-6-16(27(22,25)26)14(9-13)18(19,20)21/h2-6,9-10,23-24H,7-8H2,1H3,(H2,22,25,26) |
| InChIKey | WBFDNZXNASUGHW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |