C17H16F4N2O — CID 133330469
2-(4-fluorophenyl)-6-methyl-4-[3-(trifluoromethyl)-2-pyridinyl]morpholine (PubChem CID 133330469) has the molecular formula C17H16F4N2O and a molecular weight of 340.32 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6-methyl-4-[3-(trifluoromethyl)-2-pyridinyl]morpholine.
| Compound Name | 2-(4-fluorophenyl)-6-methyl-4-[3-(trifluoromethyl)-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 133330469 |
| Molecular Formula | C17H16F4N2O |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(4-fluorophenyl)-6-methyl-4-[3-(trifluoromethyl)-2-pyridinyl]morpholine |
| SMILES | CC1CN(c2ncccc2C(F)(F)F)CC(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C17H16F4N2O/c1-11-9-23(16-14(17(19,20)21)3-2-8-22-16)10-15(24-11)12-4-6-13(18)7-5-12/h2-8,11,15H,9-10H2,1H3 |
| InChIKey | AZWOYANJKVPPFN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |