C18H16F2N2O — CID 133330519
2-fluoro-6-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]benzonitrile (PubChem CID 133330519) has the molecular formula C18H16F2N2O and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-fluoro-6-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]benzonitrile.
| Compound Name | 2-fluoro-6-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 133330519 |
| Molecular Formula | C18H16F2N2O |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-fluoro-6-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]benzonitrile |
| SMILES | CC1CN(c2cccc(F)c2C#N)CC(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C18H16F2N2O/c1-12-10-22(17-4-2-3-16(20)15(17)9-21)11-18(23-12)13-5-7-14(19)8-6-13/h2-8,12,18H,10-11H2,1H3 |
| InChIKey | HHUCIDKSAZICEZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |