C18H17FN2O2 — CID 133330508
2-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]-1,3-benzoxazole (PubChem CID 133330508) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]-1,3-benzoxazole.
| Compound Name | 2-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 133330508 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]-1,3-benzoxazole |
| SMILES | CC1CN(c2nc3ccccc3o2)CC(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C18H17FN2O2/c1-12-10-21(18-20-15-4-2-3-5-16(15)23-18)11-17(22-12)13-6-8-14(19)9-7-13/h2-9,12,17H,10-11H2,1H3 |
| InChIKey | QKFDMBWMQMHVKT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |