C17H16FN3O — CID 133330522
2-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]pyridine-3-carbonitrile (PubChem CID 133330522) has the molecular formula C17H16FN3O and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133330522 |
| Molecular Formula | C17H16FN3O |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]pyridine-3-carbonitrile |
| SMILES | CC1CN(c2ncccc2C#N)CC(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C17H16FN3O/c1-12-10-21(17-14(9-19)3-2-8-20-17)11-16(22-12)13-4-6-15(18)7-5-13/h2-8,12,16H,10-11H2,1H3 |
| InChIKey | OKGPJYYNNDRTFH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |