C17H21ClF3N3O2 — CID 133333851
[5-chloro-6-[[3-(trifluoromethyl)cyclohexyl]amino]-3-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 133333851) has the molecular formula C17H21ClF3N3O2 and a molecular weight of 391.82 g/mol. Its IUPAC name is [5-chloro-6-[[3-(trifluoromethyl)cyclohexyl]amino]-3-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [5-chloro-6-[[3-(trifluoromethyl)cyclohexyl]amino]-3-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 133333851 |
| Molecular Formula | C17H21ClF3N3O2 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | [5-chloro-6-[[3-(trifluoromethyl)cyclohexyl]amino]-3-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cnc(NC2CCCC(C(F)(F)F)C2)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C17H21ClF3N3O2/c18-14-8-11(16(25)24-4-6-26-7-5-24)10-22-15(14)23-13-3-1-2-12(9-13)17(19,20)21/h8,10,12-13H,1-7,9H2,(H,22,23) |
| InChIKey | UJFJDLLTAWGZGX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |