C19H22F3N5O — CID 133336067
4-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-2-pyridin-3-yl-6-(trifluoromethyl)pyrimidine (PubChem CID 133336067) has the molecular formula C19H22F3N5O and a molecular weight of 393.41 g/mol. Its IUPAC name is 4-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-2-pyridin-3-yl-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-2-pyridin-3-yl-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 133336067 |
| Molecular Formula | C19H22F3N5O |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 4-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-2-pyridin-3-yl-6-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1cc(N2CCN(CC3CCOC3)CC2)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C19H22F3N5O/c20-19(21,22)16-10-17(25-18(24-16)15-2-1-4-23-11-15)27-7-5-26(6-8-27)12-14-3-9-28-13-14/h1-2,4,10-11,14H,3,5-9,12-13H2 |
| InChIKey | RPAAUGRXGQSNMS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |