C18H27N3O5S2 — CID 133338058
N-(3-ethylsulfinylcyclohexyl)-4-nitro-2-pyrrolidin-1-ylsulfonylaniline (PubChem CID 133338058) has the molecular formula C18H27N3O5S2 and a molecular weight of 429.56 g/mol. Its IUPAC name is N-(3-ethylsulfinylcyclohexyl)-4-nitro-2-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-(3-ethylsulfinylcyclohexyl)-4-nitro-2-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 133338058 |
| Molecular Formula | C18H27N3O5S2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-(3-ethylsulfinylcyclohexyl)-4-nitro-2-pyrrolidin-1-ylsulfonylaniline |
| SMILES | CCS(=O)C1CCCC(Nc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCCC2)C1 |
| InChI | InChI=1S/C18H27N3O5S2/c1-2-27(24)16-7-5-6-14(12-16)19-17-9-8-15(21(22)23)13-18(17)28(25,26)20-10-3-4-11-20/h8-9,13-14,16,19H,2-7,10-12H2,1H3 |
| InChIKey | POCGQDCZOSGVKN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|