C18H20Cl2N4O2 — CID 133342273
5-[(1-tert-butyl-5-oxopyrrolidin-3-yl)amino]-4-chloro-2-(4-chlorophenyl)pyridazin-3-one (PubChem CID 133342273) has the molecular formula C18H20Cl2N4O2 and a molecular weight of 395.29 g/mol. Its IUPAC name is 5-[(1-tert-butyl-5-oxopyrrolidin-3-yl)amino]-4-chloro-2-(4-chlorophenyl)pyridazin-3-one.
| Compound Name | 5-[(1-tert-butyl-5-oxopyrrolidin-3-yl)amino]-4-chloro-2-(4-chlorophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 133342273 |
| Molecular Formula | C18H20Cl2N4O2 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 5-[(1-tert-butyl-5-oxopyrrolidin-3-yl)amino]-4-chloro-2-(4-chlorophenyl)pyridazin-3-one |
| SMILES | CC(C)(C)N1CC(Nc2cnn(-c3ccc(Cl)cc3)c(=O)c2Cl)CC1=O |
| InChI | InChI=1S/C18H20Cl2N4O2/c1-18(2,3)23-10-12(8-15(23)25)22-14-9-21-24(17(26)16(14)20)13-6-4-11(19)5-7-13/h4-7,9,12,22H,8,10H2,1-3H3 |
| InChIKey | WZZSLZNEGMTIHZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |